C18H25N3O3Si — CID 175031512
(5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxylic acid (PubChem CID 175031512) has the molecular formula C18H25N3O3Si and a molecular weight of 359.50 g/mol. Its IUPAC name is (5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxylic acid.
| Compound Name | (5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxylic acid |
|---|---|
| PubChem CID | 175031512 |
| Molecular Formula | C18H25N3O3Si |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H](c2ccccc2)n2nc(C(=O)O)nc21 |
| InChI | InChI=1S/C18H25N3O3Si/c1-18(2,3)25(4,5)24-14-11-13(12-9-7-6-8-10-12)21-16(14)19-15(20-21)17(22)23/h6-10,13-14H,11H2,1-5H3,(H,22,23)/t13-,14-/m0/s1 |
| InChIKey | GANMHXDOQRARNQ-KBPBESRZSA-N |
| XLogP | 4.03 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|