C19H17FN4O — CID 134563941
(5S,7S)-7-fluoro-N-methyl-N,5-diphenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxamide (PubChem CID 134563941) has the molecular formula C19H17FN4O and a molecular weight of 336.37 g/mol. Its IUPAC name is (5S,7S)-7-fluoro-N-methyl-N,5-diphenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxamide.
| Compound Name | (5S,7S)-7-fluoro-N-methyl-N,5-diphenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxamide |
|---|---|
| PubChem CID | 134563941 |
| Molecular Formula | C19H17FN4O |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (5S,7S)-7-fluoro-N-methyl-N,5-diphenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carboxamide |
| SMILES | CN(C(=O)c1nc2n(n1)[C@H](c1ccccc1)C[C@@H]2F)c1ccccc1 |
| InChI | InChI=1S/C19H17FN4O/c1-23(14-10-6-3-7-11-14)19(25)17-21-18-15(20)12-16(24(18)22-17)13-8-4-2-5-9-13/h2-11,15-16H,12H2,1H3/t15-,16-/m0/s1 |
| InChIKey | HLSZYTQCBRQCSG-HOTGVXAUSA-N |
| XLogP | 3.56 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |