C13H11BrFN3O — CID 137408362
2-bromo-1-(7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)ethanone (PubChem CID 137408362) has the molecular formula C13H11BrFN3O and a molecular weight of 324.15 g/mol. Its IUPAC name is 2-bromo-1-(7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)ethanone.
| Compound Name | 2-bromo-1-(7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)ethanone |
|---|---|
| PubChem CID | 137408362 |
| Molecular Formula | C13H11BrFN3O |
| Molecular Weight | 324.15 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 2-bromo-1-(7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl)ethanone |
| SMILES | O=C(CBr)c1nc2n(n1)C(c1ccccc1)CC2F |
| InChI | InChI=1S/C13H11BrFN3O/c14-7-11(19)12-16-13-9(15)6-10(18(13)17-12)8-4-2-1-3-5-8/h1-5,9-10H,6-7H2 |
| InChIKey | CSUYWVQYZRHLEE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.15 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|