C22H28OSSi — CID 15191432
tert-butyl-[[(2S)-5-methyl-2,3-dihydrothiophen-2-yl]methoxy]-diphenylsilane (PubChem CID 15191432) has the molecular formula C22H28OSSi and a molecular weight of 368.62 g/mol. Its IUPAC name is tert-butyl-[[(2S)-5-methyl-2,3-dihydrothiophen-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S)-5-methyl-2,3-dihydrothiophen-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 15191432 |
| Molecular Formula | C22H28OSSi |
| Molecular Weight | 368.62 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | tert-butyl-[[(2S)-5-methyl-2,3-dihydrothiophen-2-yl]methoxy]-diphenylsilane |
| SMILES | CC1=CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)S1 |
| InChI | InChI=1S/C22H28OSSi/c1-18-15-16-19(24-18)17-23-25(22(2,3)4,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-15,19H,16-17H2,1-4H3/t19-/m0/s1 |
| InChIKey | KQAHHDQQUDANQR-IBGZPJMESA-N |
| XLogP | 4.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|