C23H32OS2Si — CID 11004259
tert-butyl-[2-(2-methyl-1,3-dithian-2-yl)ethoxy]-diphenylsilane (PubChem CID 11004259) has the molecular formula C23H32OS2Si and a molecular weight of 416.73 g/mol. Its IUPAC name is tert-butyl-[2-(2-methyl-1,3-dithian-2-yl)ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-(2-methyl-1,3-dithian-2-yl)ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11004259 |
| Molecular Formula | C23H32OS2Si |
| Molecular Weight | 416.73 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | tert-butyl-[2-(2-methyl-1,3-dithian-2-yl)ethoxy]-diphenylsilane |
| SMILES | CC1(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)SCCCS1 |
| InChI | InChI=1S/C23H32OS2Si/c1-22(2,3)27(20-12-7-5-8-13-20,21-14-9-6-10-15-21)24-17-16-23(4)25-18-11-19-26-23/h5-10,12-15H,11,16-19H2,1-4H3 |
| InChIKey | RYBZZRUBPXWQDQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.73 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|