C50H70O2S2Si2 — CID 134875180
tert-butyl-[(1R,2R,3S,4S)-3-[tert-butyl(diphenyl)silyl]oxy-1-[2-(1,3-dithian-2-yl)propan-2-yl]-2,4-dimethylnon-8-enoxy]-diphenylsilane (PubChem CID 134875180) has the molecular formula C50H70O2S2Si2 and a molecular weight of 823.41 g/mol. Its IUPAC name is tert-butyl-[(1R,2R,3S,4S)-3-[tert-butyl(diphenyl)silyl]oxy-1-[2-(1,3-dithian-2-yl)propan-2-yl]-2,4-dimethylnon-8-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(1R,2R,3S,4S)-3-[tert-butyl(diphenyl)silyl]oxy-1-[2-(1,3-dithian-2-yl)propan-2-yl]-2,4-dimethylnon-8-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 134875180 |
| Molecular Formula | C50H70O2S2Si2 |
| Molecular Weight | 823.41 g/mol |
| Exact Mass | 822.44 |
| IUPAC Name | tert-butyl-[(1R,2R,3S,4S)-3-[tert-butyl(diphenyl)silyl]oxy-1-[2-(1,3-dithian-2-yl)propan-2-yl]-2,4-dimethylnon-8-enoxy]-diphenylsilane |
| SMILES | C=CCCC[C@H](C)[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)(C)C1SCCCS1 |
| InChI | InChI=1S/C50H70O2S2Si2/c1-12-13-18-28-39(2)45(51-55(48(4,5)6,41-29-19-14-20-30-41)42-31-21-15-22-32-42)40(3)46(50(10,11)47-53-37-27-38-54-47)52-56(49(7,8)9,43-33-23-16-24-34-43)44-35-25-17-26-36-44/h12,14-17,19-26,29-36,39-40,45-47H,1,13,18,27-28,37-38H2,2-11H3/t39-,40+,45-,46+/m0/s1 |
| InChIKey | IOIOOCSIFKSQMC-CQRNUGIMSA-N |
| XLogP | 11.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.41 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|