C33H44O2S2Si — CID 10962787
tert-butyl-[(2R,3R)-2-methyl-6-(1-oxo-1,3-dithian-2-yl)-1-phenylhexan-3-yl]oxy-diphenylsilane (PubChem CID 10962787) has the molecular formula C33H44O2S2Si and a molecular weight of 564.93 g/mol. Its IUPAC name is tert-butyl-[(2R,3R)-2-methyl-6-(1-oxo-1,3-dithian-2-yl)-1-phenylhexan-3-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2R,3R)-2-methyl-6-(1-oxo-1,3-dithian-2-yl)-1-phenylhexan-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 10962787 |
| Molecular Formula | C33H44O2S2Si |
| Molecular Weight | 564.93 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | tert-butyl-[(2R,3R)-2-methyl-6-(1-oxo-1,3-dithian-2-yl)-1-phenylhexan-3-yl]oxy-diphenylsilane |
| SMILES | C[C@H](Cc1ccccc1)[C@@H](CCCC1SCCCS1=O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H44O2S2Si/c1-27(26-28-16-8-5-9-17-28)31(22-14-23-32-36-24-15-25-37(32)34)35-38(33(2,3)4,29-18-10-6-11-19-29)30-20-12-7-13-21-30/h5-13,16-21,27,31-32H,14-15,22-26H2,1-4H3/t27-,31-,32?,37?/m1/s1 |
| InChIKey | OCVAZBZNTZVDFB-QBDNECOOSA-N |
| XLogP | 7.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.93 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|