C28H28O2SSi — CID 135055399
[(1S,2R)-1-[(R)-methylsulfinyl]-1-phenylpropan-2-yl]oxy-triphenylsilane (PubChem CID 135055399) has the molecular formula C28H28O2SSi and a molecular weight of 456.68 g/mol. Its IUPAC name is [(1S,2R)-1-[(R)-methylsulfinyl]-1-phenylpropan-2-yl]oxy-triphenylsilane.
| Compound Name | [(1S,2R)-1-[(R)-methylsulfinyl]-1-phenylpropan-2-yl]oxy-triphenylsilane |
|---|---|
| PubChem CID | 135055399 |
| Molecular Formula | C28H28O2SSi |
| Molecular Weight | 456.68 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | [(1S,2R)-1-[(R)-methylsulfinyl]-1-phenylpropan-2-yl]oxy-triphenylsilane |
| SMILES | C[C@@H](O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)[C@H](c1ccccc1)[S@@](C)=O |
| InChI | InChI=1S/C28H28O2SSi/c1-23(28(31(2)29)24-15-7-3-8-16-24)30-32(25-17-9-4-10-18-25,26-19-11-5-12-20-26)27-21-13-6-14-22-27/h3-23,28H,1-2H3/t23-,28-,31-/m1/s1 |
| InChIKey | YYVQTIOTAHBHIT-MRLTYDNFSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.68 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|