C35H40OSSi — CID 135049507
tert-butyl-[(E)-4-methyl-1-phenyl-3-phenylsulfanylhex-4-enoxy]-diphenylsilane (PubChem CID 135049507) has the molecular formula C35H40OSSi and a molecular weight of 536.86 g/mol. Its IUPAC name is tert-butyl-[(E)-4-methyl-1-phenyl-3-phenylsulfanylhex-4-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E)-4-methyl-1-phenyl-3-phenylsulfanylhex-4-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 135049507 |
| Molecular Formula | C35H40OSSi |
| Molecular Weight | 536.86 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | tert-butyl-[(E)-4-methyl-1-phenyl-3-phenylsulfanylhex-4-enoxy]-diphenylsilane |
| SMILES | C/C=C(\C)C(CC(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C35H40OSSi/c1-6-28(2)34(37-30-21-13-8-14-22-30)27-33(29-19-11-7-12-20-29)36-38(35(3,4)5,31-23-15-9-16-24-31)32-25-17-10-18-26-32/h6-26,33-34H,27H2,1-5H3/b28-6+ |
| InChIKey | WOFBGKLJNZOHQS-LYOATTTOSA-N |
| XLogP | 8.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.86 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|