C20H18OS — CID 10935675
(1S,2S)-1,2-diphenyl-2-phenylsulfanylethanol (PubChem CID 10935675) has the molecular formula C20H18OS and a molecular weight of 306.43 g/mol. Its IUPAC name is (1S,2S)-1,2-diphenyl-2-phenylsulfanylethanol.
| Compound Name | (1S,2S)-1,2-diphenyl-2-phenylsulfanylethanol |
|---|---|
| PubChem CID | 10935675 |
| Molecular Formula | C20H18OS |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | (1S,2S)-1,2-diphenyl-2-phenylsulfanylethanol |
| SMILES | O[C@@H](c1ccccc1)[C@@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18OS/c21-19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)22-18-14-8-3-9-15-18/h1-15,19-21H/t19-,20-/m0/s1 |
| InChIKey | YGLFESHQPFAHJN-PMACEKPBSA-N |
| XLogP | 5.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |