C21H25BO3S — CID 162645612
[4-(cyclohexylmethylsulfanyl)phenyl]-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanol (PubChem CID 162645612) has the molecular formula C21H25BO3S and a molecular weight of 368.31 g/mol. Its IUPAC name is [4-(cyclohexylmethylsulfanyl)phenyl]-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanol.
| Compound Name | [4-(cyclohexylmethylsulfanyl)phenyl]-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanol |
|---|---|
| PubChem CID | 162645612 |
| Molecular Formula | C21H25BO3S |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | [4-(cyclohexylmethylsulfanyl)phenyl]-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanol |
| SMILES | OB1OCc2ccc(C(O)c3ccc(SCC4CCCCC4)cc3)cc21 |
| InChI | InChI=1S/C21H25BO3S/c23-21(17-6-7-18-13-25-22(24)20(18)12-17)16-8-10-19(11-9-16)26-14-15-4-2-1-3-5-15/h6-12,15,21,23-24H,1-5,13-14H2 |
| InChIKey | ZJIVVNSVPZMQMT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|