C33H38OSSi — CID 134929826
tert-butyl-[(1R,2R)-2-ethylsulfanyl-2-(4-methylphenyl)-1-phenylethoxy]-diphenylsilane (PubChem CID 134929826) has the molecular formula C33H38OSSi and a molecular weight of 510.82 g/mol. Its IUPAC name is tert-butyl-[(1R,2R)-2-ethylsulfanyl-2-(4-methylphenyl)-1-phenylethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(1R,2R)-2-ethylsulfanyl-2-(4-methylphenyl)-1-phenylethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 134929826 |
| Molecular Formula | C33H38OSSi |
| Molecular Weight | 510.82 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | tert-butyl-[(1R,2R)-2-ethylsulfanyl-2-(4-methylphenyl)-1-phenylethoxy]-diphenylsilane |
| SMILES | CCS[C@H](c1ccc(C)cc1)[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C33H38OSSi/c1-6-35-32(28-24-22-26(2)23-25-28)31(27-16-10-7-11-17-27)34-36(33(3,4)5,29-18-12-8-13-19-29)30-20-14-9-15-21-30/h7-25,31-32H,6H2,1-5H3/t31-,32-/m1/s1 |
| InChIKey | IAECRDKLXBZMLV-ROJLCIKYSA-N |
| XLogP | 8.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.82 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|