C25H38OSSi — CID 134929578
tert-butyl-[(1R,2R)-2-tert-butylsulfanyl-2-(4-methylphenyl)-1-phenylethoxy]-dimethylsilane (PubChem CID 134929578) has the molecular formula C25H38OSSi and a molecular weight of 414.73 g/mol. Its IUPAC name is tert-butyl-[(1R,2R)-2-tert-butylsulfanyl-2-(4-methylphenyl)-1-phenylethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2R)-2-tert-butylsulfanyl-2-(4-methylphenyl)-1-phenylethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134929578 |
| Molecular Formula | C25H38OSSi |
| Molecular Weight | 414.73 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | tert-butyl-[(1R,2R)-2-tert-butylsulfanyl-2-(4-methylphenyl)-1-phenylethoxy]-dimethylsilane |
| SMILES | Cc1ccc([C@@H](SC(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H38OSSi/c1-19-15-17-21(18-16-19)23(27-24(2,3)4)22(20-13-11-10-12-14-20)26-28(8,9)25(5,6)7/h10-18,22-23H,1-9H3/t22-,23-/m1/s1 |
| InChIKey | ZPAHIXZOIODNLP-DHIUTWEWSA-N |
| XLogP | 8.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.73 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|