C34H48OSSi — CID 57190581
tert-butyl-[(2S,4R)-4,6-dimethyl-1-tritylsulfanylheptan-2-yl]oxy-dimethylsilane (PubChem CID 57190581) has the molecular formula C34H48OSSi and a molecular weight of 532.91 g/mol. Its IUPAC name is tert-butyl-[(2S,4R)-4,6-dimethyl-1-tritylsulfanylheptan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,4R)-4,6-dimethyl-1-tritylsulfanylheptan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 57190581 |
| Molecular Formula | C34H48OSSi |
| Molecular Weight | 532.91 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | tert-butyl-[(2S,4R)-4,6-dimethyl-1-tritylsulfanylheptan-2-yl]oxy-dimethylsilane |
| SMILES | CC(C)C[C@@H](C)C[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H48OSSi/c1-27(2)24-28(3)25-32(35-37(7,8)33(4,5)6)26-36-34(29-18-12-9-13-19-29,30-20-14-10-15-21-30)31-22-16-11-17-23-31/h9-23,27-28,32H,24-26H2,1-8H3/t28-,32+/m1/s1 |
| InChIKey | SLQJIIWILKGMDS-NSJVFKKDSA-N |
| XLogP | 10.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.91 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|