C33H46OSi — CID 135001610
tert-butyl-diphenyl-(2-phenylundecan-3-yloxy)silane (PubChem CID 135001610) has the molecular formula C33H46OSi and a molecular weight of 486.82 g/mol. Its IUPAC name is tert-butyl-diphenyl-(2-phenylundecan-3-yloxy)silane.
| Compound Name | tert-butyl-diphenyl-(2-phenylundecan-3-yloxy)silane |
|---|---|
| PubChem CID | 135001610 |
| Molecular Formula | C33H46OSi |
| Molecular Weight | 486.82 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | tert-butyl-diphenyl-(2-phenylundecan-3-yloxy)silane |
| SMILES | CCCCCCCCC(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)c1ccccc1 |
| InChI | InChI=1S/C33H46OSi/c1-6-7-8-9-10-20-27-32(28(2)29-21-14-11-15-22-29)34-35(33(3,4)5,30-23-16-12-17-24-30)31-25-18-13-19-26-31/h11-19,21-26,28,32H,6-10,20,27H2,1-5H3 |
| InChIKey | KTQBKKLBUMVSDX-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.82 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|