C32H42O2SSi — CID 10815792
tert-butyl-[(2S)-2-[(2R,5S)-5-methyl-6-phenylsulfanyloxan-2-yl]butoxy]-diphenylsilane (PubChem CID 10815792) has the molecular formula C32H42O2SSi and a molecular weight of 518.84 g/mol. Its IUPAC name is tert-butyl-[(2S)-2-[(2R,5S)-5-methyl-6-phenylsulfanyloxan-2-yl]butoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S)-2-[(2R,5S)-5-methyl-6-phenylsulfanyloxan-2-yl]butoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10815792 |
| Molecular Formula | C32H42O2SSi |
| Molecular Weight | 518.84 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | tert-butyl-[(2S)-2-[(2R,5S)-5-methyl-6-phenylsulfanyloxan-2-yl]butoxy]-diphenylsilane |
| SMILES | CC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1CC[C@H](C)C(Sc2ccccc2)O1 |
| InChI | InChI=1S/C32H42O2SSi/c1-6-26(30-23-22-25(2)31(34-30)35-27-16-10-7-11-17-27)24-33-36(32(3,4)5,28-18-12-8-13-19-28)29-20-14-9-15-21-29/h7-21,25-26,30-31H,6,22-24H2,1-5H3/t25-,26-,30+,31?/m0/s1 |
| InChIKey | LZVAFTDZMQWMGY-LVUVJVQQSA-N |
| XLogP | 7.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.84 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|