C43H64O2S2Si2 — CID 10974640
tert-butyl-[(3R,4R,5S,6S)-2-(1,3-dithian-2-yl)-2,4,6,10-tetramethyl-3-triphenylsilyloxyundec-10-en-5-yl]oxy-dimethylsilane (PubChem CID 10974640) has the molecular formula C43H64O2S2Si2 and a molecular weight of 733.29 g/mol. Its IUPAC name is tert-butyl-[(3R,4R,5S,6S)-2-(1,3-dithian-2-yl)-2,4,6,10-tetramethyl-3-triphenylsilyloxyundec-10-en-5-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4R,5S,6S)-2-(1,3-dithian-2-yl)-2,4,6,10-tetramethyl-3-triphenylsilyloxyundec-10-en-5-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10974640 |
| Molecular Formula | C43H64O2S2Si2 |
| Molecular Weight | 733.29 g/mol |
| Exact Mass | 732.39 |
| IUPAC Name | tert-butyl-[(3R,4R,5S,6S)-2-(1,3-dithian-2-yl)-2,4,6,10-tetramethyl-3-triphenylsilyloxyundec-10-en-5-yl]oxy-dimethylsilane |
| SMILES | C=C(C)CCC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)C(C)(C)C1SCCCS1 |
| InChI | InChI=1S/C43H64O2S2Si2/c1-33(2)23-21-24-34(3)39(44-48(10,11)42(5,6)7)35(4)40(43(8,9)41-46-31-22-32-47-41)45-49(36-25-15-12-16-26-36,37-27-17-13-18-28-37)38-29-19-14-20-30-38/h12-20,25-30,34-35,39-41H,1,21-24,31-32H2,2-11H3/t34-,35+,39-,40+/m0/s1 |
| InChIKey | GYMWOYSPNJFQEE-XZFVVDAASA-N |
| XLogP | 10.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.29 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|