C33H52OS2Si — CID 134936485
tert-butyl-[6-(2-heptyl-1,3-dithian-2-yl)hexoxy]-diphenylsilane (PubChem CID 134936485) has the molecular formula C33H52OS2Si and a molecular weight of 557.00 g/mol. Its IUPAC name is tert-butyl-[6-(2-heptyl-1,3-dithian-2-yl)hexoxy]-diphenylsilane.
| Compound Name | tert-butyl-[6-(2-heptyl-1,3-dithian-2-yl)hexoxy]-diphenylsilane |
|---|---|
| PubChem CID | 134936485 |
| Molecular Formula | C33H52OS2Si |
| Molecular Weight | 557.00 g/mol |
| Exact Mass | 556.32 |
| IUPAC Name | tert-butyl-[6-(2-heptyl-1,3-dithian-2-yl)hexoxy]-diphenylsilane |
| SMILES | CCCCCCCC1(CCCCCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)SCCCS1 |
| InChI | InChI=1S/C33H52OS2Si/c1-5-6-7-8-17-25-33(35-28-20-29-36-33)26-18-9-10-19-27-34-37(32(2,3)4,30-21-13-11-14-22-30)31-23-15-12-16-24-31/h11-16,21-24H,5-10,17-20,25-29H2,1-4H3 |
| InChIKey | PGNIMCGICHHRDY-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.00 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|