C31H46O3S2Si — CID 11974078
tert-butyl-[2-[(4R,6S)-6-[2-(1,3-dithian-2-yl)propan-2-yl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy]-diphenylsilane (PubChem CID 11974078) has the molecular formula C31H46O3S2Si and a molecular weight of 558.93 g/mol. Its IUPAC name is tert-butyl-[2-[(4R,6S)-6-[2-(1,3-dithian-2-yl)propan-2-yl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(4R,6S)-6-[2-(1,3-dithian-2-yl)propan-2-yl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11974078 |
| Molecular Formula | C31H46O3S2Si |
| Molecular Weight | 558.93 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | tert-butyl-[2-[(4R,6S)-6-[2-(1,3-dithian-2-yl)propan-2-yl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy]-diphenylsilane |
| SMILES | CC1(C)O[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H](C(C)(C)C2SCCCS2)O1 |
| InChI | InChI=1S/C31H46O3S2Si/c1-29(2,3)37(25-15-10-8-11-16-25,26-17-12-9-13-18-26)32-20-19-24-23-27(34-31(6,7)33-24)30(4,5)28-35-21-14-22-36-28/h8-13,15-18,24,27-28H,14,19-23H2,1-7H3/t24-,27+/m1/s1 |
| InChIKey | VGZFHVVSQNGYPY-SQHAQQRYSA-N |
| XLogP | 7.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.93 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|