C35H52O2S2Si — CID 11215528
tert-butyl-[2-[(2R,3S,6S)-3-methyl-6-[[2-[(E)-4-methylpent-1-enyl]-1,3-dithian-2-yl]methyl]oxan-2-yl]ethoxy]-diphenylsilane (PubChem CID 11215528) has the molecular formula C35H52O2S2Si and a molecular weight of 597.02 g/mol. Its IUPAC name is tert-butyl-[2-[(2R,3S,6S)-3-methyl-6-[[2-[(E)-4-methylpent-1-enyl]-1,3-dithian-2-yl]methyl]oxan-2-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(2R,3S,6S)-3-methyl-6-[[2-[(E)-4-methylpent-1-enyl]-1,3-dithian-2-yl]methyl]oxan-2-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11215528 |
| Molecular Formula | C35H52O2S2Si |
| Molecular Weight | 597.02 g/mol |
| Exact Mass | 596.32 |
| IUPAC Name | tert-butyl-[2-[(2R,3S,6S)-3-methyl-6-[[2-[(E)-4-methylpent-1-enyl]-1,3-dithian-2-yl]methyl]oxan-2-yl]ethoxy]-diphenylsilane |
| SMILES | CC(C)C/C=C/C1(C[C@@H]2CC[C@H](C)[C@@H](CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)SCCCS1 |
| InChI | InChI=1S/C35H52O2S2Si/c1-28(2)15-13-23-35(38-25-14-26-39-35)27-30-21-20-29(3)33(37-30)22-24-36-40(34(4,5)6,31-16-9-7-10-17-31)32-18-11-8-12-19-32/h7-13,16-19,23,28-30,33H,14-15,20-22,24-27H2,1-6H3/b23-13+/t29-,30-,33+/m0/s1 |
| InChIKey | STGNUUDILCEMAK-OKNMBDDDSA-N |
| XLogP | 8.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.02 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|