C30H46O4S2Si — CID 134928318
(4S,6R)-6-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-hydroxybutyl]-3,3-dimethyl-2-(3-sulfanylpropylsulfanyl)oxan-4-ol (PubChem CID 134928318) has the molecular formula C30H46O4S2Si and a molecular weight of 562.91 g/mol. Its IUPAC name is (4S,6R)-6-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-hydroxybutyl]-3,3-dimethyl-2-(3-sulfanylpropylsulfanyl)oxan-4-ol.
| Compound Name | (4S,6R)-6-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-hydroxybutyl]-3,3-dimethyl-2-(3-sulfanylpropylsulfanyl)oxan-4-ol |
|---|---|
| PubChem CID | 134928318 |
| Molecular Formula | C30H46O4S2Si |
| Molecular Weight | 562.91 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | (4S,6R)-6-[(2S)-4-[tert-butyl(diphenyl)silyl]oxy-2-hydroxybutyl]-3,3-dimethyl-2-(3-sulfanylpropylsulfanyl)oxan-4-ol |
| SMILES | CC1(C)C(SCCCS)O[C@H](C[C@@H](O)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C30H46O4S2Si/c1-29(2,3)37(25-13-8-6-9-14-25,26-15-10-7-11-16-26)33-18-17-23(31)21-24-22-27(32)30(4,5)28(34-24)36-20-12-19-35/h6-11,13-16,23-24,27-28,31-32,35H,12,17-22H2,1-5H3/t23-,24+,27-,28?/m0/s1 |
| InChIKey | OMTNYCJEYHNMHV-ICOMTJTFSA-N |
| XLogP | 5.26 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.91 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|