C28H42O2S2Si — CID 10673088
(3R,5R)-1-[tert-butyl(diphenyl)silyl]oxy-5-(1,3-dithian-2-yl)-2,2-dimethylhexan-3-ol (PubChem CID 10673088) has the molecular formula C28H42O2S2Si and a molecular weight of 502.86 g/mol. Its IUPAC name is (3R,5R)-1-[tert-butyl(diphenyl)silyl]oxy-5-(1,3-dithian-2-yl)-2,2-dimethylhexan-3-ol.
| Compound Name | (3R,5R)-1-[tert-butyl(diphenyl)silyl]oxy-5-(1,3-dithian-2-yl)-2,2-dimethylhexan-3-ol |
|---|---|
| PubChem CID | 10673088 |
| Molecular Formula | C28H42O2S2Si |
| Molecular Weight | 502.86 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | (3R,5R)-1-[tert-butyl(diphenyl)silyl]oxy-5-(1,3-dithian-2-yl)-2,2-dimethylhexan-3-ol |
| SMILES | C[C@H](C[C@@H](O)C(C)(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C1SCCCS1 |
| InChI | InChI=1S/C28H42O2S2Si/c1-22(26-31-18-13-19-32-26)20-25(29)28(5,6)21-30-33(27(2,3)4,23-14-9-7-10-15-23)24-16-11-8-12-17-24/h7-12,14-17,22,25-26,29H,13,18-21H2,1-6H3/t22-,25-/m1/s1 |
| InChIKey | WHNNHCGJYWWQPF-RCZVLFRGSA-N |
| XLogP | 6.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.86 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|