C25H34O2S2Si — CID 134936259
(2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-(1,3-dithian-2-yl)pent-4-en-2-ol (PubChem CID 134936259) has the molecular formula C25H34O2S2Si and a molecular weight of 458.77 g/mol. Its IUPAC name is (2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-(1,3-dithian-2-yl)pent-4-en-2-ol.
| Compound Name | (2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-(1,3-dithian-2-yl)pent-4-en-2-ol |
|---|---|
| PubChem CID | 134936259 |
| Molecular Formula | C25H34O2S2Si |
| Molecular Weight | 458.77 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-(1,3-dithian-2-yl)pent-4-en-2-ol |
| SMILES | C=C[C@@H](C1SCCCS1)[C@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H34O2S2Si/c1-5-22(24-28-17-12-18-29-24)23(26)19-27-30(25(2,3)4,20-13-8-6-9-14-20)21-15-10-7-11-16-21/h5-11,13-16,22-24,26H,1,12,17-19H2,2-4H3/t22-,23-/m1/s1 |
| InChIKey | PYQQQHSXVOMYSQ-DHIUTWEWSA-N |
| XLogP | 4.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.77 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|