C34H54O2S2Si2 — CID 134937020
(E,2S)-1-[tert-butyl(diphenyl)silyl]oxy-5-[2-tri(propan-2-yl)silyl-1,3-dithian-2-yl]pent-3-en-2-ol (PubChem CID 134937020) has the molecular formula C34H54O2S2Si2 and a molecular weight of 615.11 g/mol. Its IUPAC name is (E,2S)-1-[tert-butyl(diphenyl)silyl]oxy-5-[2-tri(propan-2-yl)silyl-1,3-dithian-2-yl]pent-3-en-2-ol.
| Compound Name | (E,2S)-1-[tert-butyl(diphenyl)silyl]oxy-5-[2-tri(propan-2-yl)silyl-1,3-dithian-2-yl]pent-3-en-2-ol |
|---|---|
| PubChem CID | 134937020 |
| Molecular Formula | C34H54O2S2Si2 |
| Molecular Weight | 615.11 g/mol |
| Exact Mass | 614.31 |
| IUPAC Name | (E,2S)-1-[tert-butyl(diphenyl)silyl]oxy-5-[2-tri(propan-2-yl)silyl-1,3-dithian-2-yl]pent-3-en-2-ol |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)C1(C/C=C/[C@H](O)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)SCCCS1 |
| InChI | InChI=1S/C34H54O2S2Si2/c1-27(2)39(28(3)4,29(5)6)34(37-24-17-25-38-34)23-16-18-30(35)26-36-40(33(7,8)9,31-19-12-10-13-20-31)32-21-14-11-15-22-32/h10-16,18-22,27-30,35H,17,23-26H2,1-9H3/b18-16+/t30-/m0/s1 |
| InChIKey | ZKEAPFHSIIIRRL-RWSAHWFZSA-N |
| XLogP | 8.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.11 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|