C27H42O3S2Si — CID 11103174
(2R,3S)-1-[tert-butyl(diphenyl)silyl]oxy-5,5-bis(propylsulfanyl)pentane-2,3-diol (PubChem CID 11103174) has the molecular formula C27H42O3S2Si and a molecular weight of 506.85 g/mol. Its IUPAC name is (2R,3S)-1-[tert-butyl(diphenyl)silyl]oxy-5,5-bis(propylsulfanyl)pentane-2,3-diol.
| Compound Name | (2R,3S)-1-[tert-butyl(diphenyl)silyl]oxy-5,5-bis(propylsulfanyl)pentane-2,3-diol |
|---|---|
| PubChem CID | 11103174 |
| Molecular Formula | C27H42O3S2Si |
| Molecular Weight | 506.85 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | (2R,3S)-1-[tert-butyl(diphenyl)silyl]oxy-5,5-bis(propylsulfanyl)pentane-2,3-diol |
| SMILES | CCCSC(C[C@H](O)[C@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)SCCC |
| InChI | InChI=1S/C27H42O3S2Si/c1-6-18-31-26(32-19-7-2)20-24(28)25(29)21-30-33(27(3,4)5,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,24-26,28-29H,6-7,18-21H2,1-5H3/t24-,25+/m0/s1 |
| InChIKey | JEYVFWSOLCBEIK-LOSJGSFVSA-N |
| XLogP | 5.29 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.85 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|