C25H34O2SSi — CID 102082772
(2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-(prop-2-enylsulfanylmethyl)pent-4-en-2-ol (PubChem CID 102082772) has the molecular formula C25H34O2SSi and a molecular weight of 426.70 g/mol. Its IUPAC name is (2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-(prop-2-enylsulfanylmethyl)pent-4-en-2-ol.
| Compound Name | (2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-(prop-2-enylsulfanylmethyl)pent-4-en-2-ol |
|---|---|
| PubChem CID | 102082772 |
| Molecular Formula | C25H34O2SSi |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | (2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-(prop-2-enylsulfanylmethyl)pent-4-en-2-ol |
| SMILES | C=CCSC[C@H](C=C)[C@@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H34O2SSi/c1-6-18-28-20-21(7-2)24(26)19-27-29(25(3,4)5,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h6-17,21,24,26H,1-2,18-20H2,3-5H3/t21-,24-/m0/s1 |
| InChIKey | XQKQOLGMDFCHTD-URXFXBBRSA-N |
| XLogP | 4.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.70 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|