C31H52O3S2Si2 — CID 101336016
(2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5,5-bis(ethylsulfanyl)-2-triethylsilyloxypentan-1-ol (PubChem CID 101336016) has the molecular formula C31H52O3S2Si2 and a molecular weight of 593.06 g/mol. Its IUPAC name is (2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5,5-bis(ethylsulfanyl)-2-triethylsilyloxypentan-1-ol.
| Compound Name | (2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5,5-bis(ethylsulfanyl)-2-triethylsilyloxypentan-1-ol |
|---|---|
| PubChem CID | 101336016 |
| Molecular Formula | C31H52O3S2Si2 |
| Molecular Weight | 593.06 g/mol |
| Exact Mass | 592.29 |
| IUPAC Name | (2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-5,5-bis(ethylsulfanyl)-2-triethylsilyloxypentan-1-ol |
| SMILES | CCSC(C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](CO)O[Si](CC)(CC)CC)SCC |
| InChI | InChI=1S/C31H52O3S2Si2/c1-9-35-30(36-10-2)24-28(29(25-32)33-37(11-3,12-4)13-5)34-38(31(6,7)8,26-20-16-14-17-21-26)27-22-18-15-19-23-27/h14-23,28-30,32H,9-13,24-25H2,1-8H3/t28-,29+/m0/s1 |
| InChIKey | MKJAZSGVAYKUKE-URLMMPGGSA-N |
| XLogP | 7.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.06 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|