C25H34O3S2Si — CID 46180439
(7R,10R,11R)-7-[tert-butyl(diphenyl)silyl]oxy-1,5-dithiaspiro[5.5]undecane-10,11-diol (PubChem CID 46180439) has the molecular formula C25H34O3S2Si and a molecular weight of 474.76 g/mol. Its IUPAC name is (7R,10R,11R)-7-[tert-butyl(diphenyl)silyl]oxy-1,5-dithiaspiro[5.5]undecane-10,11-diol.
| Compound Name | (7R,10R,11R)-7-[tert-butyl(diphenyl)silyl]oxy-1,5-dithiaspiro[5.5]undecane-10,11-diol |
|---|---|
| PubChem CID | 46180439 |
| Molecular Formula | C25H34O3S2Si |
| Molecular Weight | 474.76 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | (7R,10R,11R)-7-[tert-butyl(diphenyl)silyl]oxy-1,5-dithiaspiro[5.5]undecane-10,11-diol |
| SMILES | CC(C)(C)[Si](O[C@@H]1CC[C@@H](O)[C@@H](O)C12SCCCS2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H34O3S2Si/c1-24(2,3)31(19-11-6-4-7-12-19,20-13-8-5-9-14-20)28-22-16-15-21(26)23(27)25(22)29-17-10-18-30-25/h4-9,11-14,21-23,26-27H,10,15-18H2,1-3H3/t21-,22-,23-/m1/s1 |
| InChIKey | PWJWDPKIHPZMKD-DNVJHFABSA-N |
| XLogP | 4.01 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.76 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|