C24H34O5SSi — CID 11397091
(2S,3R,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethylsulfanyloxane-3,4,5-triol (PubChem CID 11397091) has the molecular formula C24H34O5SSi and a molecular weight of 462.68 g/mol. Its IUPAC name is (2S,3R,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethylsulfanyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 11397091 |
| Molecular Formula | C24H34O5SSi |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethylsulfanyloxane-3,4,5-triol |
| SMILES | CCS[C@@H]1O[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H34O5SSi/c1-5-30-23-22(27)21(26)20(25)19(29-23)16-28-31(24(2,3)4,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-15,19-23,25-27H,5,16H2,1-4H3/t19-,20-,21+,22+,23-/m0/s1 |
| InChIKey | UEUCUEWVZYTVGJ-JFCAZQBUSA-N |
| XLogP | 2.12 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|