C29H38O5S2Si — CID 135013978
[(7R,10R,11R)-11-acetyloxy-7-[tert-butyl(diphenyl)silyl]oxy-1,5-dithiaspiro[5.5]undecan-10-yl] acetate (PubChem CID 135013978) has the molecular formula C29H38O5S2Si and a molecular weight of 558.84 g/mol. Its IUPAC name is [(7R,10R,11R)-11-acetyloxy-7-[tert-butyl(diphenyl)silyl]oxy-1,5-dithiaspiro[5.5]undecan-10-yl] acetate.
| Compound Name | [(7R,10R,11R)-11-acetyloxy-7-[tert-butyl(diphenyl)silyl]oxy-1,5-dithiaspiro[5.5]undecan-10-yl] acetate |
|---|---|
| PubChem CID | 135013978 |
| Molecular Formula | C29H38O5S2Si |
| Molecular Weight | 558.84 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | [(7R,10R,11R)-11-acetyloxy-7-[tert-butyl(diphenyl)silyl]oxy-1,5-dithiaspiro[5.5]undecan-10-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)CC[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C12SCCCS2 |
| InChI | InChI=1S/C29H38O5S2Si/c1-21(30)32-25-17-18-26(29(27(25)33-22(2)31)35-19-12-20-36-29)34-37(28(3,4)5,23-13-8-6-9-14-23)24-15-10-7-11-16-24/h6-11,13-16,25-27H,12,17-20H2,1-5H3/t25-,26-,27-/m1/s1 |
| InChIKey | NQIQZMOFQLTKIL-ZONZVBGPSA-N |
| XLogP | 5.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.84 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|