C29H40O6SSi — CID 91527637
[(3aS,4R,7R,7aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethylsulfanyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate (PubChem CID 91527637) has the molecular formula C29H40O6SSi and a molecular weight of 544.79 g/mol. Its IUPAC name is [(3aS,4R,7R,7aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethylsulfanyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate.
| Compound Name | [(3aS,4R,7R,7aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethylsulfanyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
|---|---|
| PubChem CID | 91527637 |
| Molecular Formula | C29H40O6SSi |
| Molecular Weight | 544.79 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | [(3aS,4R,7R,7aS)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-ethylsulfanyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
| SMILES | CCSC1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C29H40O6SSi/c1-8-36-27-26(32-20(2)30)25-24(34-29(6,7)35-25)23(33-27)19-31-37(28(3,4)5,21-15-11-9-12-16-21)22-17-13-10-14-18-22/h9-18,23-27H,8,19H2,1-7H3/t23-,24+,25+,26-,27?/m1/s1 |
| InChIKey | MSXQYIYEWISPHW-TYQVVOABSA-N |
| XLogP | 4.49 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.79 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|