C26H34O5SSi — CID 44550295
2-[(2R,3R,4S)-3-acetyloxy-4-[tert-butyl(diphenyl)silyl]oxythiolan-2-yl]ethyl acetate (PubChem CID 44550295) has the molecular formula C26H34O5SSi and a molecular weight of 486.71 g/mol. Its IUPAC name is 2-[(2R,3R,4S)-3-acetyloxy-4-[tert-butyl(diphenyl)silyl]oxythiolan-2-yl]ethyl acetate.
| Compound Name | 2-[(2R,3R,4S)-3-acetyloxy-4-[tert-butyl(diphenyl)silyl]oxythiolan-2-yl]ethyl acetate |
|---|---|
| PubChem CID | 44550295 |
| Molecular Formula | C26H34O5SSi |
| Molecular Weight | 486.71 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 2-[(2R,3R,4S)-3-acetyloxy-4-[tert-butyl(diphenyl)silyl]oxythiolan-2-yl]ethyl acetate |
| SMILES | CC(=O)OCC[C@H]1SC[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H34O5SSi/c1-19(27)29-17-16-24-25(30-20(2)28)23(18-32-24)31-33(26(3,4)5,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-15,23-25H,16-18H2,1-5H3/t23-,24-,25-/m1/s1 |
| InChIKey | YBBCIPNLVFLUDB-UBFVSLLYSA-N |
| XLogP | 3.93 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.71 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|