C29H33FO3SSeSi — CID 10940928
[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-3-phenylselanylthiolan-2-yl] acetate (PubChem CID 10940928) has the molecular formula C29H33FO3SSeSi and a molecular weight of 587.69 g/mol. Its IUPAC name is [(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-3-phenylselanylthiolan-2-yl] acetate.
| Compound Name | [(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-3-phenylselanylthiolan-2-yl] acetate |
|---|---|
| PubChem CID | 10940928 |
| Molecular Formula | C29H33FO3SSeSi |
| Molecular Weight | 587.69 g/mol |
| Exact Mass | 588.11 |
| IUPAC Name | [(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-3-phenylselanylthiolan-2-yl] acetate |
| SMILES | CC(=O)OC1S[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@]1(F)[Se]c1ccccc1 |
| InChI | InChI=1S/C29H33FO3SSeSi/c1-22(31)33-27-29(30,35-24-14-8-5-9-15-24)20-23(34-27)21-32-36(28(2,3)4,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-19,23,27H,20-21H2,1-4H3/t23-,27?,29+/m0/s1 |
| InChIKey | BNDBYSBLSQZWEU-ZRLFNVIWSA-N |
| XLogP | 4.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.69 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|