C29H34O4SeSi — CID 10792833
[(3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-phenylselanyloxolan-2-yl] acetate (PubChem CID 10792833) has the molecular formula C29H34O4SeSi and a molecular weight of 553.63 g/mol. Its IUPAC name is [(3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-phenylselanyloxolan-2-yl] acetate.
| Compound Name | [(3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-phenylselanyloxolan-2-yl] acetate |
|---|---|
| PubChem CID | 10792833 |
| Molecular Formula | C29H34O4SeSi |
| Molecular Weight | 553.63 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | [(3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-phenylselanyloxolan-2-yl] acetate |
| SMILES | CC(=O)OC1O[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H]1[Se]c1ccccc1 |
| InChI | InChI=1S/C29H34O4SeSi/c1-22(30)32-28-27(34-24-14-8-5-9-15-24)20-23(33-28)21-31-35(29(2,3)4,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-19,23,27-28H,20-21H2,1-4H3/t23-,27+,28?/m1/s1 |
| InChIKey | INYRCMCFNCZUJP-OYHIBXGMSA-N |
| XLogP | 4.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|