C38H62O7SSi3 — CID 11320191
[(5aR,6R,8S,9R,9aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-ethylsulfanyl-2,2,4,4-tetra(propan-2-yl)-6,8,9,9a-tetrahydro-5aH-pyrano[3,4-f][1,3,5,2,4]trioxadisilepin-9-yl] acetate (PubChem CID 11320191) has the molecular formula C38H62O7SSi3 and a molecular weight of 747.23 g/mol. Its IUPAC name is [(5aR,6R,8S,9R,9aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-ethylsulfanyl-2,2,4,4-tetra(propan-2-yl)-6,8,9,9a-tetrahydro-5aH-pyrano[3,4-f][1,3,5,2,4]trioxadisilepin-9-yl] acetate.
| Compound Name | [(5aR,6R,8S,9R,9aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-ethylsulfanyl-2,2,4,4-tetra(propan-2-yl)-6,8,9,9a-tetrahydro-5aH-pyrano[3,4-f][1,3,5,2,4]trioxadisilepin-9-yl] acetate |
|---|---|
| PubChem CID | 11320191 |
| Molecular Formula | C38H62O7SSi3 |
| Molecular Weight | 747.23 g/mol |
| Exact Mass | 746.35 |
| IUPAC Name | [(5aR,6R,8S,9R,9aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-ethylsulfanyl-2,2,4,4-tetra(propan-2-yl)-6,8,9,9a-tetrahydro-5aH-pyrano[3,4-f][1,3,5,2,4]trioxadisilepin-9-yl] acetate |
| SMILES | CCS[C@@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]2O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O[C@@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C38H62O7SSi3/c1-14-46-37-36(41-30(10)39)35-34(43-48(26(2)3,27(4)5)45-49(44-35,28(6)7)29(8)9)33(42-37)25-40-47(38(11,12)13,31-21-17-15-18-22-31)32-23-19-16-20-24-32/h15-24,26-29,33-37H,14,25H2,1-13H3/t33-,34-,35+,36-,37+/m1/s1 |
| InChIKey | PMNGMWJGEAGJSN-MANRWTMFSA-N |
| XLogP | 8.30 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.23 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|