C32H44O8SSi — CID 20739083
methyl 4-[[7-acetyloxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]sulfanyl]butanoate (PubChem CID 20739083) has the molecular formula C32H44O8SSi and a molecular weight of 616.85 g/mol. Its IUPAC name is methyl 4-[[7-acetyloxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]sulfanyl]butanoate.
| Compound Name | methyl 4-[[7-acetyloxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]sulfanyl]butanoate |
|---|---|
| PubChem CID | 20739083 |
| Molecular Formula | C32H44O8SSi |
| Molecular Weight | 616.85 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | methyl 4-[[7-acetyloxy-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]sulfanyl]butanoate |
| SMILES | COC(=O)CCCSC1OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C2OC(C)(C)OC2C1OC(C)=O |
| InChI | InChI=1S/C32H44O8SSi/c1-22(33)37-29-28-27(39-32(5,6)40-28)25(38-30(29)41-20-14-19-26(34)35-7)21-36-42(31(2,3)4,23-15-10-8-11-16-23)24-17-12-9-13-18-24/h8-13,15-18,25,27-30H,14,19-21H2,1-7H3 |
| InChIKey | AOYNURIEGXTIJX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.85 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|