C34H40O8SSi — CID 11456421
[(2R,3R,4S,5S,6R)-4,5-diacetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylsulfanyloxan-3-yl] acetate (PubChem CID 11456421) has the molecular formula C34H40O8SSi and a molecular weight of 636.84 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-4,5-diacetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylsulfanyloxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-4,5-diacetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylsulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 11456421 |
| Molecular Formula | C34H40O8SSi |
| Molecular Weight | 636.84 g/mol |
| Exact Mass | 636.22 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-4,5-diacetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylsulfanyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](Sc2ccccc2)O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C34H40O8SSi/c1-23(35)39-30-29(22-38-44(34(4,5)6,27-18-12-8-13-19-27)28-20-14-9-15-21-28)42-33(43-26-16-10-7-11-17-26)32(41-25(3)37)31(30)40-24(2)36/h7-21,29-33H,22H2,1-6H3/t29-,30-,31+,32+,33-/m1/s1 |
| InChIKey | UGUUAPHBAOQBEJ-UZGUBXJASA-N |
| XLogP | 4.88 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.84 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|