C25H38O4S2Si — CID 11271885
(2S,3R,4R)-5-[tert-butyl(diphenyl)silyl]oxy-1,1-bis(ethylsulfanyl)pentane-2,3,4-triol (PubChem CID 11271885) has the molecular formula C25H38O4S2Si and a molecular weight of 494.80 g/mol. Its IUPAC name is (2S,3R,4R)-5-[tert-butyl(diphenyl)silyl]oxy-1,1-bis(ethylsulfanyl)pentane-2,3,4-triol.
| Compound Name | (2S,3R,4R)-5-[tert-butyl(diphenyl)silyl]oxy-1,1-bis(ethylsulfanyl)pentane-2,3,4-triol |
|---|---|
| PubChem CID | 11271885 |
| Molecular Formula | C25H38O4S2Si |
| Molecular Weight | 494.80 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | (2S,3R,4R)-5-[tert-butyl(diphenyl)silyl]oxy-1,1-bis(ethylsulfanyl)pentane-2,3,4-triol |
| SMILES | CCSC(SCC)[C@@H](O)[C@H](O)[C@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H38O4S2Si/c1-6-30-24(31-7-2)23(28)22(27)21(26)18-29-32(25(3,4)5,19-14-10-8-11-15-19)20-16-12-9-13-17-20/h8-17,21-24,26-28H,6-7,18H2,1-5H3/t21-,22-,23+/m1/s1 |
| InChIKey | LUIIAQQZFPGPPP-ZLNRFVROSA-N |
| XLogP | 3.48 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.80 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|