C21H27FO2SSi — CID 10763004
(3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-fluorothiolan-3-ol (PubChem CID 10763004) has the molecular formula C21H27FO2SSi and a molecular weight of 390.60 g/mol. Its IUPAC name is (3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-fluorothiolan-3-ol.
| Compound Name | (3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-fluorothiolan-3-ol |
|---|---|
| PubChem CID | 10763004 |
| Molecular Formula | C21H27FO2SSi |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (3S,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-fluorothiolan-3-ol |
| SMILES | CC(C)(C)[Si](OC[C@@H]1SC[C@@H](O)[C@H]1F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27FO2SSi/c1-21(2,3)26(16-10-6-4-7-11-16,17-12-8-5-9-13-17)24-14-19-20(22)18(23)15-25-19/h4-13,18-20,23H,14-15H2,1-3H3/t18-,19+,20-/m1/s1 |
| InChIKey | LBGPTWJOKHSTLS-HSALFYBXSA-N |
| XLogP | 3.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|