C22H32O3Si — CID 101380523
(3R,4R)-1-[tert-butyl(diphenyl)silyl]oxyhexane-3,4-diol (PubChem CID 101380523) has the molecular formula C22H32O3Si and a molecular weight of 372.58 g/mol. Its IUPAC name is (3R,4R)-1-[tert-butyl(diphenyl)silyl]oxyhexane-3,4-diol.
| Compound Name | (3R,4R)-1-[tert-butyl(diphenyl)silyl]oxyhexane-3,4-diol |
|---|---|
| PubChem CID | 101380523 |
| Molecular Formula | C22H32O3Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | (3R,4R)-1-[tert-butyl(diphenyl)silyl]oxyhexane-3,4-diol |
| SMILES | CC[C@@H](O)[C@H](O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H32O3Si/c1-5-20(23)21(24)16-17-25-26(22(2,3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,20-21,23-24H,5,16-17H2,1-4H3/t20-,21-/m1/s1 |
| InChIKey | RFOJVLVYHGWROC-NHCUHLMSSA-N |
| XLogP | 3.08 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|