C37H66O3S2Si3 — CID 101336015
[(2R,3S)-5,5-bis(ethylsulfanyl)-1,2-bis(triethylsilyloxy)pentan-3-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 101336015) has the molecular formula C37H66O3S2Si3 and a molecular weight of 707.32 g/mol. Its IUPAC name is [(2R,3S)-5,5-bis(ethylsulfanyl)-1,2-bis(triethylsilyloxy)pentan-3-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(2R,3S)-5,5-bis(ethylsulfanyl)-1,2-bis(triethylsilyloxy)pentan-3-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 101336015 |
| Molecular Formula | C37H66O3S2Si3 |
| Molecular Weight | 707.32 g/mol |
| Exact Mass | 706.38 |
| IUPAC Name | [(2R,3S)-5,5-bis(ethylsulfanyl)-1,2-bis(triethylsilyloxy)pentan-3-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | CCSC(C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](CO[Si](CC)(CC)CC)O[Si](CC)(CC)CC)SCC |
| InChI | InChI=1S/C37H66O3S2Si3/c1-12-41-36(42-13-2)30-34(35(39-44(17-6,18-7)19-8)31-38-43(14-3,15-4)16-5)40-45(37(9,10)11,32-26-22-20-23-27-32)33-28-24-21-25-29-33/h20-29,34-36H,12-19,30-31H2,1-11H3/t34-,35+/m0/s1 |
| InChIKey | KGHYHLGBJKQWLG-OIDHKYIRSA-N |
| XLogP | 10.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.32 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|