C29H46O2S2Si2 — CID 85380496
tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dithian-2-yl)propoxy]-diphenylsilane (PubChem CID 85380496) has the molecular formula C29H46O2S2Si2 and a molecular weight of 546.99 g/mol. Its IUPAC name is tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dithian-2-yl)propoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dithian-2-yl)propoxy]-diphenylsilane |
|---|---|
| PubChem CID | 85380496 |
| Molecular Formula | C29H46O2S2Si2 |
| Molecular Weight | 546.99 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dithian-2-yl)propoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC1SCCCS1 |
| InChI | InChI=1S/C29H46O2S2Si2/c1-28(2,3)34(7,8)31-24(22-27-32-20-15-21-33-27)23-30-35(29(4,5)6,25-16-11-9-12-17-25)26-18-13-10-14-19-26/h9-14,16-19,24,27H,15,20-23H2,1-8H3 |
| InChIKey | JBNYQCJYTOHZFC-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.99 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|