C36H58O5S2Si — CID 10908505
(2S,4R,6S)-8-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethoxy-1-[2-[(2R)-2-methoxypentyl]-1,3-dithian-2-yl]octan-2-ol (PubChem CID 10908505) has the molecular formula C36H58O5S2Si and a molecular weight of 663.08 g/mol. Its IUPAC name is (2S,4R,6S)-8-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethoxy-1-[2-[(2R)-2-methoxypentyl]-1,3-dithian-2-yl]octan-2-ol.
| Compound Name | (2S,4R,6S)-8-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethoxy-1-[2-[(2R)-2-methoxypentyl]-1,3-dithian-2-yl]octan-2-ol |
|---|---|
| PubChem CID | 10908505 |
| Molecular Formula | C36H58O5S2Si |
| Molecular Weight | 663.08 g/mol |
| Exact Mass | 662.35 |
| IUPAC Name | (2S,4R,6S)-8-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethoxy-1-[2-[(2R)-2-methoxypentyl]-1,3-dithian-2-yl]octan-2-ol |
| SMILES | CCC[C@H](CC1(C[C@@H](O)C[C@H](C[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC)OC)SCCCS1)OC |
| InChI | InChI=1S/C36H58O5S2Si/c1-8-16-31(39-6)28-36(42-23-15-24-43-36)27-29(37)25-32(40-7)26-30(38-5)21-22-41-44(35(2,3)4,33-17-11-9-12-18-33)34-19-13-10-14-20-34/h9-14,17-20,29-32,37H,8,15-16,21-28H2,1-7H3/t29-,30-,31+,32+/m0/s1 |
| InChIKey | OECMBGRDHYWDJH-GASGPIRDSA-N |
| XLogP | 7.29 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.08 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|