C26H38O3SSi — CID 10906623
(1S)-1-[(1S,2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-oxothian-2-yl]-2,2-dimethylpropan-1-ol (PubChem CID 10906623) has the molecular formula C26H38O3SSi and a molecular weight of 458.74 g/mol. Its IUPAC name is (1S)-1-[(1S,2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-oxothian-2-yl]-2,2-dimethylpropan-1-ol.
| Compound Name | (1S)-1-[(1S,2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-oxothian-2-yl]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 10906623 |
| Molecular Formula | C26H38O3SSi |
| Molecular Weight | 458.74 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (1S)-1-[(1S,2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-oxothian-2-yl]-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(C)[C@H](O)[C@@H]1C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC[S@@]1=O |
| InChI | InChI=1S/C26H38O3SSi/c1-25(2,3)24(27)23-19-20(17-18-30(23)28)29-31(26(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20,23-24,27H,17-19H2,1-6H3/t20-,23-,24+,30-/m0/s1 |
| InChIKey | FRPAQSZHSXCKTK-KGPFVPCYSA-N |
| XLogP | 4.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.74 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|