C30H46O3S — CID 18752782
8-(8-hydroxy-5-methyl-5-phenyloctyl)sulfinyl-4-methyl-4-phenyloctan-1-ol (PubChem CID 18752782) has the molecular formula C30H46O3S and a molecular weight of 486.76 g/mol. Its IUPAC name is 8-(8-hydroxy-5-methyl-5-phenyloctyl)sulfinyl-4-methyl-4-phenyloctan-1-ol.
| Compound Name | 8-(8-hydroxy-5-methyl-5-phenyloctyl)sulfinyl-4-methyl-4-phenyloctan-1-ol |
|---|---|
| PubChem CID | 18752782 |
| Molecular Formula | C30H46O3S |
| Molecular Weight | 486.76 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | 8-(8-hydroxy-5-methyl-5-phenyloctyl)sulfinyl-4-methyl-4-phenyloctan-1-ol |
| SMILES | CC(CCCO)(CCCCS(=O)CCCCC(C)(CCCO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H46O3S/c1-29(21-13-23-31,27-15-5-3-6-16-27)19-9-11-25-34(33)26-12-10-20-30(2,22-14-24-32)28-17-7-4-8-18-28/h3-8,15-18,31-32H,9-14,19-26H2,1-2H3 |
| InChIKey | QVBUQAYMFGEIAK-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.76 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|