C37H52O3S2Si — CID 11114886
tert-butyl-[(E,2S,4R)-6-[2-[[(4S,6R)-6-ethynyl-2,2,6-trimethyl-1,3-dioxan-4-yl]methyl]-1,3-dithian-2-yl]-4-methylhex-5-en-2-yl]oxy-diphenylsilane (PubChem CID 11114886) has the molecular formula C37H52O3S2Si and a molecular weight of 637.04 g/mol. Its IUPAC name is tert-butyl-[(E,2S,4R)-6-[2-[[(4S,6R)-6-ethynyl-2,2,6-trimethyl-1,3-dioxan-4-yl]methyl]-1,3-dithian-2-yl]-4-methylhex-5-en-2-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(E,2S,4R)-6-[2-[[(4S,6R)-6-ethynyl-2,2,6-trimethyl-1,3-dioxan-4-yl]methyl]-1,3-dithian-2-yl]-4-methylhex-5-en-2-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 11114886 |
| Molecular Formula | C37H52O3S2Si |
| Molecular Weight | 637.04 g/mol |
| Exact Mass | 636.31 |
| IUPAC Name | tert-butyl-[(E,2S,4R)-6-[2-[[(4S,6R)-6-ethynyl-2,2,6-trimethyl-1,3-dioxan-4-yl]methyl]-1,3-dithian-2-yl]-4-methylhex-5-en-2-yl]oxy-diphenylsilane |
| SMILES | C#C[C@@]1(C)C[C@@H](CC2(/C=C/[C@H](C)C[C@H](C)O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)SCCCS2)OC(C)(C)O1 |
| InChI | InChI=1S/C37H52O3S2Si/c1-10-36(9)27-31(38-35(7,8)40-36)28-37(41-24-17-25-42-37)23-22-29(2)26-30(3)39-43(34(4,5)6,32-18-13-11-14-19-32)33-20-15-12-16-21-33/h1,11-16,18-23,29-31H,17,24-28H2,2-9H3/b23-22+/t29-,30-,31-,36-/m0/s1 |
| InChIKey | FYPACNGDZJCIGM-MDTMITCKSA-N |
| XLogP | 8.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.04 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|