C39H64O4S2Si2 — CID 11216276
tert-butyl-[2-[(4S,6R)-6-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dithian-2-yl)-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy]-diphenylsilane (PubChem CID 11216276) has the molecular formula C39H64O4S2Si2 and a molecular weight of 717.24 g/mol. Its IUPAC name is tert-butyl-[2-[(4S,6R)-6-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dithian-2-yl)-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(4S,6R)-6-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dithian-2-yl)-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11216276 |
| Molecular Formula | C39H64O4S2Si2 |
| Molecular Weight | 717.24 g/mol |
| Exact Mass | 716.38 |
| IUPAC Name | tert-butyl-[2-[(4S,6R)-6-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dithian-2-yl)-3-methylbutyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethoxy]-diphenylsilane |
| SMILES | CC1(C)O[C@@H](C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C2SCCCS2)C[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C39H64O4S2Si2/c1-36(2,3)46(11,12)43-34(38(7,8)35-44-26-19-27-45-35)29-31-28-30(41-39(9,10)42-31)24-25-40-47(37(4,5)6,32-20-15-13-16-21-32)33-22-17-14-18-23-33/h13-18,20-23,30-31,34-35H,19,24-29H2,1-12H3/t30-,31+,34-/m0/s1 |
| InChIKey | MUDIDECXSWPIND-HHMOXRITSA-N |
| XLogP | 9.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.24 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|