C24H32O2S2Si — CID 11048531
[2-[4-(1,3-dioxolan-2-yl)butyl]-1,3-dithian-2-yl]-methyl-diphenylsilane (PubChem CID 11048531) has the molecular formula C24H32O2S2Si and a molecular weight of 444.74 g/mol. Its IUPAC name is [2-[4-(1,3-dioxolan-2-yl)butyl]-1,3-dithian-2-yl]-methyl-diphenylsilane.
| Compound Name | [2-[4-(1,3-dioxolan-2-yl)butyl]-1,3-dithian-2-yl]-methyl-diphenylsilane |
|---|---|
| PubChem CID | 11048531 |
| Molecular Formula | C24H32O2S2Si |
| Molecular Weight | 444.74 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | [2-[4-(1,3-dioxolan-2-yl)butyl]-1,3-dithian-2-yl]-methyl-diphenylsilane |
| SMILES | C[Si](c1ccccc1)(c1ccccc1)C1(CCCCC2OCCO2)SCCCS1 |
| InChI | InChI=1S/C24H32O2S2Si/c1-29(21-11-4-2-5-12-21,22-13-6-3-7-14-22)24(27-19-10-20-28-24)16-9-8-15-23-25-17-18-26-23/h2-7,11-14,23H,8-10,15-20H2,1H3 |
| InChIKey | SMXZREMXXWDLNV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.74 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|