C28H42O3S2Si — CID 134878579
tert-butyl-[(1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-bis(ethylsulfanyl)propoxy]-diphenylsilane (PubChem CID 134878579) has the molecular formula C28H42O3S2Si and a molecular weight of 518.86 g/mol. Its IUPAC name is tert-butyl-[(1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-bis(ethylsulfanyl)propoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-bis(ethylsulfanyl)propoxy]-diphenylsilane |
|---|---|
| PubChem CID | 134878579 |
| Molecular Formula | C28H42O3S2Si |
| Molecular Weight | 518.86 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | tert-butyl-[(1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-bis(ethylsulfanyl)propoxy]-diphenylsilane |
| SMILES | CCSC(C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1COC(C)(C)O1)SCC |
| InChI | InChI=1S/C28H42O3S2Si/c1-8-32-26(33-9-2)20-24(25-21-29-28(6,7)30-25)31-34(27(3,4)5,22-16-12-10-13-17-22)23-18-14-11-15-19-23/h10-19,24-26H,8-9,20-21H2,1-7H3/t24-,25-/m1/s1 |
| InChIKey | LGQONOBSPZJRKM-JWQCQUIFSA-N |
| XLogP | 6.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.86 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|