C25H34O3Si — CID 10884105
tert-butyl-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enoxy]-diphenylsilane (PubChem CID 10884105) has the molecular formula C25H34O3Si and a molecular weight of 410.63 g/mol. Its IUPAC name is tert-butyl-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10884105 |
| Molecular Formula | C25H34O3Si |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | tert-butyl-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enoxy]-diphenylsilane |
| SMILES | C=CC[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C25H34O3Si/c1-7-14-22(23-19-26-25(5,6)27-23)28-29(24(2,3)4,20-15-10-8-11-16-20)21-17-12-9-13-18-21/h7-13,15-18,22-23H,1,14,19H2,2-6H3/t22-,23+/m0/s1 |
| InChIKey | ORHPYGSEOTYNEQ-XZOQPEGZSA-N |
| XLogP | 4.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|